C21H34O3SSi — CID 11112025
tert-butyl (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanylpent-4-enoate (PubChem CID 11112025) has the molecular formula C21H34O3SSi and a molecular weight of 394.65 g/mol. Its IUPAC name is tert-butyl (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanylpent-4-enoate.
| Compound Name | tert-butyl (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanylpent-4-enoate |
|---|---|
| PubChem CID | 11112025 |
| Molecular Formula | C21H34O3SSi |
| Molecular Weight | 394.65 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | tert-butyl (E)-3-[tert-butyl(dimethyl)silyl]oxy-5-phenylsulfanylpent-4-enoate |
| SMILES | CC(C)(C)OC(=O)CC(/C=C/Sc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H34O3SSi/c1-20(2,3)23-19(22)16-17(24-26(7,8)21(4,5)6)14-15-25-18-12-10-9-11-13-18/h9-15,17H,16H2,1-8H3/b15-14+ |
| InChIKey | BMDWAYDCVRCUPG-CCEZHUSRSA-N |
| XLogP | 6.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.65 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|