C36H54O3SSi2 — CID 134885297
tert-butyl-dimethyl-[[(3Z,8Z,14E)-5-methyl-4-phenylsulfanyl-15-tri(propan-2-yl)silyloxy-1-oxacyclopentadeca-3,8,14-trien-6,10-diyn-5-yl]oxy]silane (PubChem CID 134885297) has the molecular formula C36H54O3SSi2 and a molecular weight of 623.06 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(3Z,8Z,14E)-5-methyl-4-phenylsulfanyl-15-tri(propan-2-yl)silyloxy-1-oxacyclopentadeca-3,8,14-trien-6,10-diyn-5-yl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(3Z,8Z,14E)-5-methyl-4-phenylsulfanyl-15-tri(propan-2-yl)silyloxy-1-oxacyclopentadeca-3,8,14-trien-6,10-diyn-5-yl]oxy]silane |
|---|---|
| PubChem CID | 134885297 |
| Molecular Formula | C36H54O3SSi2 |
| Molecular Weight | 623.06 g/mol |
| Exact Mass | 622.33 |
| IUPAC Name | tert-butyl-dimethyl-[[(3Z,8Z,14E)-5-methyl-4-phenylsulfanyl-15-tri(propan-2-yl)silyloxy-1-oxacyclopentadeca-3,8,14-trien-6,10-diyn-5-yl]oxy]silane |
| SMILES | CC(C)[Si](O/C1=C/CCC#C/C=C\C#CC(C)(O[Si](C)(C)C(C)(C)C)/C(Sc2ccccc2)=C/CO1)(C(C)C)C(C)C |
| InChI | InChI=1S/C36H54O3SSi2/c1-29(2)42(30(3)4,31(5)6)38-34-25-21-16-14-13-15-17-22-27-36(10,39-41(11,12)35(7,8)9)33(26-28-37-34)40-32-23-19-18-20-24-32/h15,17-20,23-26,29-31H,16,21,28H2,1-12H3/b17-15-,33-26-,34-25+ |
| InChIKey | IJJKOBQJINNOHA-GTDBDOFYSA-N |
| XLogP | 10.85 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.06 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|