C28H44O4SSi — CID 102089641
tert-butyl (4E,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-10-oxo-12-phenylsulfanyldodeca-4,7-dienoate (PubChem CID 102089641) has the molecular formula C28H44O4SSi and a molecular weight of 504.81 g/mol. Its IUPAC name is tert-butyl (4E,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-10-oxo-12-phenylsulfanyldodeca-4,7-dienoate.
| Compound Name | tert-butyl (4E,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-10-oxo-12-phenylsulfanyldodeca-4,7-dienoate |
|---|---|
| PubChem CID | 102089641 |
| Molecular Formula | C28H44O4SSi |
| Molecular Weight | 504.81 g/mol |
| Exact Mass | 504.27 |
| IUPAC Name | tert-butyl (4E,6S,7Z)-6-[tert-butyl(dimethyl)silyl]oxy-10-oxo-12-phenylsulfanyldodeca-4,7-dienoate |
| SMILES | CC(C)(C)OC(=O)CC/C=C/[C@@H](/C=C\CC(=O)CCSc1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C28H44O4SSi/c1-27(2,3)31-26(30)20-13-12-16-24(32-34(7,8)28(4,5)6)17-14-15-23(29)21-22-33-25-18-10-9-11-19-25/h9-12,14,16-19,24H,13,15,20-22H2,1-8H3/b16-12+,17-14-/t24-/m0/s1 |
| InChIKey | YMCAYEKEJFJKDI-KIJAPBKASA-N |
| XLogP | 7.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.81 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|