C18H29FO2SSi — CID 158806202
methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one (PubChem CID 158806202) has the molecular formula C18H29FO2SSi and a molecular weight of 356.58 g/mol. Its IUPAC name is methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one.
| Compound Name | methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one |
|---|---|
| PubChem CID | 158806202 |
| Molecular Formula | C18H29FO2SSi |
| Molecular Weight | 356.58 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | methane;trans-(3S,4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(4-fluorophenyl)sulfanylcyclopentan-1-one |
| SMILES | C.CC(C)(C)[Si](C)(C)O[C@H]1CC(=O)C[C@@H]1Sc1ccc(F)cc1 |
| InChI | InChI=1S/C17H25FO2SSi.CH4/c1-17(2,3)22(4,5)20-15-10-13(19)11-16(15)21-14-8-6-12(18)7-9-14;/h6-9,15-16H,10-11H2,1-5H3;1H4/t15-,16-;/m0./s1 |
| InChIKey | IUCLBVRCEVZXTF-MOGJOVFKSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.58 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|