C20H24O3S — CID 139654224
7-(4,7-dihydroxyhept-2-enylidene)-2-phenylsulfanylcyclohept-2-en-1-one (PubChem CID 139654224) has the molecular formula C20H24O3S and a molecular weight of 344.48 g/mol. Its IUPAC name is 7-(4,7-dihydroxyhept-2-enylidene)-2-phenylsulfanylcyclohept-2-en-1-one.
| Compound Name | 7-(4,7-dihydroxyhept-2-enylidene)-2-phenylsulfanylcyclohept-2-en-1-one |
|---|---|
| PubChem CID | 139654224 |
| Molecular Formula | C20H24O3S |
| Molecular Weight | 344.48 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | 7-(4,7-dihydroxyhept-2-enylidene)-2-phenylsulfanylcyclohept-2-en-1-one |
| SMILES | O=C1C(=CC=CC(O)CCCO)CCCC=C1Sc1ccccc1 |
| InChI | InChI=1S/C20H24O3S/c21-15-7-11-17(22)10-6-9-16-8-4-5-14-19(20(16)23)24-18-12-2-1-3-13-18/h1-3,6,9-10,12-14,17,21-22H,4-5,7-8,11,15H2 |
| InChIKey | FDJQBXLVRCLXEG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|