C23H36OSSi — CID 134919362
(4R,5S)-3,4,5-trimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one (PubChem CID 134919362) has the molecular formula C23H36OSSi and a molecular weight of 388.69 g/mol. Its IUPAC name is (4R,5S)-3,4,5-trimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one.
| Compound Name | (4R,5S)-3,4,5-trimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 134919362 |
| Molecular Formula | C23H36OSSi |
| Molecular Weight | 388.69 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | (4R,5S)-3,4,5-trimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
| SMILES | CC1=C([Si](C(C)C)(C(C)C)C(C)C)C(=O)[C@@](C)(Sc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C23H36OSSi/c1-15(2)26(16(3)4,17(5)6)21-18(7)19(8)23(9,22(21)24)25-20-13-11-10-12-14-20/h10-17,19H,1-9H3/t19-,23+/m1/s1 |
| InChIKey | PMTPFFOENVRHGS-XXBNENTESA-N |
| XLogP | 7.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.69 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|