C19H24OSSi — CID 11961875
(4R,5R)-5-(phenylsulfanylmethyl)-4-prop-2-ynyl-2-trimethylsilylcyclohex-2-en-1-one (PubChem CID 11961875) has the molecular formula C19H24OSSi and a molecular weight of 328.55 g/mol. Its IUPAC name is (4R,5R)-5-(phenylsulfanylmethyl)-4-prop-2-ynyl-2-trimethylsilylcyclohex-2-en-1-one.
| Compound Name | (4R,5R)-5-(phenylsulfanylmethyl)-4-prop-2-ynyl-2-trimethylsilylcyclohex-2-en-1-one |
|---|---|
| PubChem CID | 11961875 |
| Molecular Formula | C19H24OSSi |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (4R,5R)-5-(phenylsulfanylmethyl)-4-prop-2-ynyl-2-trimethylsilylcyclohex-2-en-1-one |
| SMILES | C#CC[C@@H]1C=C([Si](C)(C)C)C(=O)C[C@H]1CSc1ccccc1 |
| InChI | InChI=1S/C19H24OSSi/c1-5-9-15-13-19(22(2,3)4)18(20)12-16(15)14-21-17-10-7-6-8-11-17/h1,6-8,10-11,13,15-16H,9,12,14H2,2-4H3/t15-,16+/m1/s1 |
| InChIKey | BZOOCEXIRKNOPD-CVEARBPZSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|