C22H34OSSi — CID 11595920
(4R,5S)-3,4-dimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one (PubChem CID 11595920) has the molecular formula C22H34OSSi and a molecular weight of 374.67 g/mol. Its IUPAC name is (4R,5S)-3,4-dimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one.
| Compound Name | (4R,5S)-3,4-dimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 11595920 |
| Molecular Formula | C22H34OSSi |
| Molecular Weight | 374.67 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (4R,5S)-3,4-dimethyl-5-phenylsulfanyl-2-tri(propan-2-yl)silylcyclopent-2-en-1-one |
| SMILES | CC1=C([Si](C(C)C)(C(C)C)C(C)C)C(=O)[C@@H](Sc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C22H34OSSi/c1-14(2)25(15(3)4,16(5)6)22-18(8)17(7)21(20(22)23)24-19-12-10-9-11-13-19/h9-17,21H,1-8H3/t17-,21+/m1/s1 |
| InChIKey | SEDXBRGYZSKYHD-UTKZUKDTSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.67 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|