C20H30OS2Si — CID 86210677
3-phenyl-5,5-bis(propylsulfanyl)-2-trimethylsilylcyclopent-2-en-1-one (PubChem CID 86210677) has the molecular formula C20H30OS2Si and a molecular weight of 378.68 g/mol. Its IUPAC name is 3-phenyl-5,5-bis(propylsulfanyl)-2-trimethylsilylcyclopent-2-en-1-one.
| Compound Name | 3-phenyl-5,5-bis(propylsulfanyl)-2-trimethylsilylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 86210677 |
| Molecular Formula | C20H30OS2Si |
| Molecular Weight | 378.68 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-phenyl-5,5-bis(propylsulfanyl)-2-trimethylsilylcyclopent-2-en-1-one |
| SMILES | CCCSC1(SCCC)CC(c2ccccc2)=C([Si](C)(C)C)C1=O |
| InChI | InChI=1S/C20H30OS2Si/c1-6-13-22-20(23-14-7-2)15-17(16-11-9-8-10-12-16)18(19(20)21)24(3,4)5/h8-12H,6-7,13-15H2,1-5H3 |
| InChIKey | GVKAFJCMMKVWKS-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.68 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|