C16H20OS — CID 12047696
(5R)-2-methyl-5-(1-phenylsulfanylpropan-2-yl)cyclohex-2-en-1-one (PubChem CID 12047696) has the molecular formula C16H20OS and a molecular weight of 260.40 g/mol. Its IUPAC name is (5R)-2-methyl-5-(1-phenylsulfanylpropan-2-yl)cyclohex-2-en-1-one.
| Compound Name | (5R)-2-methyl-5-(1-phenylsulfanylpropan-2-yl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 12047696 |
| Molecular Formula | C16H20OS |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (5R)-2-methyl-5-(1-phenylsulfanylpropan-2-yl)cyclohex-2-en-1-one |
| SMILES | CC1=CC[C@@H](C(C)CSc2ccccc2)CC1=O |
| InChI | InChI=1S/C16H20OS/c1-12-8-9-14(10-16(12)17)13(2)11-18-15-6-4-3-5-7-15/h3-8,13-14H,9-11H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | KWKUSAGOLWDFTP-ARLHGKGLSA-N |
| XLogP | 4.34 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |