C23H26O3S — CID 123185010
6-(1-phenylsulfanylpropan-2-yl)-3-(2,4,6-trimethylphenyl)oxane-2,4-dione (PubChem CID 123185010) has the molecular formula C23H26O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 6-(1-phenylsulfanylpropan-2-yl)-3-(2,4,6-trimethylphenyl)oxane-2,4-dione.
| Compound Name | 6-(1-phenylsulfanylpropan-2-yl)-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
|---|---|
| PubChem CID | 123185010 |
| Molecular Formula | C23H26O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 6-(1-phenylsulfanylpropan-2-yl)-3-(2,4,6-trimethylphenyl)oxane-2,4-dione |
| SMILES | Cc1cc(C)c(C2C(=O)CC(C(C)CSc3ccccc3)OC2=O)c(C)c1 |
| InChI | InChI=1S/C23H26O3S/c1-14-10-15(2)21(16(3)11-14)22-19(24)12-20(26-23(22)25)17(4)13-27-18-8-6-5-7-9-18/h5-11,17,20,22H,12-13H2,1-4H3 |
| InChIKey | DHHBTGUOCKMSLW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|