C16H22OS — CID 102078346
2-[(1R,2R)-1-methyl-2-(1-phenylsulfanylpropan-2-yl)cyclobutyl]acetaldehyde (PubChem CID 102078346) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-[(1R,2R)-1-methyl-2-(1-phenylsulfanylpropan-2-yl)cyclobutyl]acetaldehyde.
| Compound Name | 2-[(1R,2R)-1-methyl-2-(1-phenylsulfanylpropan-2-yl)cyclobutyl]acetaldehyde |
|---|---|
| PubChem CID | 102078346 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-[(1R,2R)-1-methyl-2-(1-phenylsulfanylpropan-2-yl)cyclobutyl]acetaldehyde |
| SMILES | CC(CSc1ccccc1)[C@H]1CC[C@]1(C)CC=O |
| InChI | InChI=1S/C16H22OS/c1-13(12-18-14-6-4-3-5-7-14)15-8-9-16(15,2)10-11-17/h3-7,11,13,15H,8-10,12H2,1-2H3/t13?,15-,16-/m1/s1 |
| InChIKey | LSOBOEUSQZOCFJ-GNHXQJIDSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|