C13H16O — CID 78427687
cis-(1R,2S)-1-methyl-2-[(1R)-1-phenylethyl]cyclopropane-1-carbaldehyde (PubChem CID 78427687) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is cis-(1R,2S)-1-methyl-2-[(1R)-1-phenylethyl]cyclopropane-1-carbaldehyde.
| Compound Name | cis-(1R,2S)-1-methyl-2-[(1R)-1-phenylethyl]cyclopropane-1-carbaldehyde |
|---|---|
| PubChem CID | 78427687 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | cis-(1R,2S)-1-methyl-2-[(1R)-1-phenylethyl]cyclopropane-1-carbaldehyde |
| SMILES | C[C@@H](c1ccccc1)[C@@H]1C[C@@]1(C)C=O |
| InChI | InChI=1S/C13H16O/c1-10(11-6-4-3-5-7-11)12-8-13(12,2)9-14/h3-7,9-10,12H,8H2,1-2H3/t10-,12-,13-/m0/s1 |
| InChIKey | CFCUCGRZZZWNOA-DRZSPHRISA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|