C23H26O2S — CID 11046792
2-[(1S,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]acetaldehyde (PubChem CID 11046792) has the molecular formula C23H26O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-[(1S,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]acetaldehyde.
| Compound Name | 2-[(1S,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]acetaldehyde |
|---|---|
| PubChem CID | 11046792 |
| Molecular Formula | C23H26O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-[(1S,6S)-1-methyl-6-phenylmethoxy-3-(phenylsulfanylmethyl)cyclohex-2-en-1-yl]acetaldehyde |
| SMILES | C[C@]1(CC=O)C=C(CSc2ccccc2)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H26O2S/c1-23(14-15-24)16-20(18-26-21-10-6-3-7-11-21)12-13-22(23)25-17-19-8-4-2-5-9-19/h2-11,15-16,22H,12-14,17-18H2,1H3/t22-,23-/m0/s1 |
| InChIKey | PIIHFJJLMJRKAK-GOTSBHOMSA-N |
| XLogP | 5.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|