About propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate
propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate (PubChem CID 101239189) has the molecular formula C13H15F3O3S
and a molecular weight of 308.32 g/mol. Its IUPAC name is propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate.
Analyze propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate?
The IUPAC name of propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate (CID 101239189) is propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate.
What is the SMILES notation for propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate?
The canonical SMILES for propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate is CC(C)OC(=O)OC(CSc1ccccc1)C(F)(F)F.
What is the InChIKey of propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate?
The InChIKey is YJEMAMHZFSOKDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3O3S/c1-9(2)18-12(17)19-11(13(14,15)16)8-20-10-6-4-3-5-7-10/h3-7,9,11H,8H2,1-2H3.
What are the key properties of propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate?
propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate has a molecular weight of 308.32 g/mol, XLogP of 4.27, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl (1,1,1-trifluoro-3-phenylsulfanylpropan-2-yl) carbonate is sourced from PubChem (CID 101239189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).