C18H19F3O3S — CID 71334944
benzoic acid;4,4,4-trifluoro-3-(phenylsulfanylmethyl)butan-1-ol (PubChem CID 71334944) has the molecular formula C18H19F3O3S and a molecular weight of 372.41 g/mol. Its IUPAC name is benzoic acid;4,4,4-trifluoro-3-(phenylsulfanylmethyl)butan-1-ol.
| Compound Name | benzoic acid;4,4,4-trifluoro-3-(phenylsulfanylmethyl)butan-1-ol |
|---|---|
| PubChem CID | 71334944 |
| Molecular Formula | C18H19F3O3S |
| Molecular Weight | 372.41 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | benzoic acid;4,4,4-trifluoro-3-(phenylsulfanylmethyl)butan-1-ol |
| SMILES | O=C(O)c1ccccc1.OCCC(CSc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C11H13F3OS.C7H6O2/c12-11(13,14)9(6-7-15)8-16-10-4-2-1-3-5-10;8-7(9)6-4-2-1-3-5-6/h1-5,9,15H,6-8H2;1-5H,(H,8,9) |
| InChIKey | QURZVQSTSATZKW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.41 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |