About (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol
(3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol (PubChem CID 10563566) has the molecular formula C12H15F3OS
and a molecular weight of 264.31 g/mol. Its IUPAC name is (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol.
Molecular Properties
| Compound Name | (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol |
| PubChem CID | 10563566 |
| Molecular Formula | C12H15F3OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol |
| SMILES | Cc1ccc(SC[C@H](CCO)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H15F3OS/c1-9-2-4-11(5-3-9)17-8-10(6-7-16)12(13,14)15/h2-5,10,16H,6-8H2,1H3/t10-/m0/s1 |
| InChIKey | BHSAPTRPZPGDPP-JTQLQIEISA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol?
The IUPAC name of (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol (CID 10563566) is (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol.
What is the SMILES notation for (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol?
The canonical SMILES for (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol is Cc1ccc(SC[C@H](CCO)C(F)(F)F)cc1.
What is the InChIKey of (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol?
The InChIKey is BHSAPTRPZPGDPP-JTQLQIEISA-N. The full InChI is InChI=1S/C12H15F3OS/c1-9-2-4-11(5-3-9)17-8-10(6-7-16)12(13,14)15/h2-5,10,16H,6-8H2,1H3/t10-/m0/s1.
What are the key properties of (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol?
(3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol has a molecular weight of 264.31 g/mol, XLogP of 3.65, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-4,4,4-trifluoro-3-[(4-methylphenyl)sulfanylmethyl]butan-1-ol is sourced from PubChem (CID 10563566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).