C28H47NO3SSi — CID 102519827
(6E,8R,9S)-10-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxyundeca-1,6-dien-5-one (PubChem CID 102519827) has the molecular formula C28H47NO3SSi and a molecular weight of 505.84 g/mol. Its IUPAC name is (6E,8R,9S)-10-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxyundeca-1,6-dien-5-one.
| Compound Name | (6E,8R,9S)-10-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxyundeca-1,6-dien-5-one |
|---|---|
| PubChem CID | 102519827 |
| Molecular Formula | C28H47NO3SSi |
| Molecular Weight | 505.84 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | (6E,8R,9S)-10-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-8-propan-2-yl-9-triethylsilyloxyundeca-1,6-dien-5-one |
| SMILES | C=CCCC(=O)/C(=C\[C@@H](C(C)C)[C@@H](O[Si](CC)(CC)CC)C(C)C)S(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C28H47NO3SSi/c1-10-14-20-26(30)27(33(31,29-9)24-18-16-15-17-19-24)21-25(22(5)6)28(23(7)8)32-34(11-2,12-3)13-4/h10,15-19,21-23,25,28H,1,11-14,20H2,2-9H3/b27-21+/t25-,28-,33?/m0/s1 |
| InChIKey | ZWESDVHWVYAZQK-CRLQPIOHSA-N |
| XLogP | 7.88 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.84 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|