C22H37NO2SSi — CID 102396378
triethyl-[(1Z,3R,4S)-3-methyl-1-(N-methyl-S-phenylsulfonimidoyl)octa-1,7-dien-4-yl]oxysilane (PubChem CID 102396378) has the molecular formula C22H37NO2SSi and a molecular weight of 407.70 g/mol. Its IUPAC name is triethyl-[(1Z,3R,4S)-3-methyl-1-(N-methyl-S-phenylsulfonimidoyl)octa-1,7-dien-4-yl]oxysilane.
| Compound Name | triethyl-[(1Z,3R,4S)-3-methyl-1-(N-methyl-S-phenylsulfonimidoyl)octa-1,7-dien-4-yl]oxysilane |
|---|---|
| PubChem CID | 102396378 |
| Molecular Formula | C22H37NO2SSi |
| Molecular Weight | 407.70 g/mol |
| Exact Mass | 407.23 |
| IUPAC Name | triethyl-[(1Z,3R,4S)-3-methyl-1-(N-methyl-S-phenylsulfonimidoyl)octa-1,7-dien-4-yl]oxysilane |
| SMILES | C=CCC[C@H](O[Si](CC)(CC)CC)[C@H](C)/C=C\S(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C22H37NO2SSi/c1-7-11-17-22(25-27(8-2,9-3)10-4)20(5)18-19-26(24,23-6)21-15-13-12-14-16-21/h7,12-16,18-20,22H,1,8-11,17H2,2-6H3/b19-18-/t20-,22+,26?/m1/s1 |
| InChIKey | FZYOSVBZLJSVHL-SMODBCAASA-N |
| XLogP | 6.65 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.70 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|