C26H43NO2SSi — CID 15942292
triethyl-[(2E,4S,5R,6E)-7-(N-methyl-S-phenylsulfonimidoyl)-5-propan-2-yldeca-2,6,9-trien-4-yl]oxysilane (PubChem CID 15942292) has the molecular formula C26H43NO2SSi and a molecular weight of 461.79 g/mol. Its IUPAC name is triethyl-[(2E,4S,5R,6E)-7-(N-methyl-S-phenylsulfonimidoyl)-5-propan-2-yldeca-2,6,9-trien-4-yl]oxysilane.
| Compound Name | triethyl-[(2E,4S,5R,6E)-7-(N-methyl-S-phenylsulfonimidoyl)-5-propan-2-yldeca-2,6,9-trien-4-yl]oxysilane |
|---|---|
| PubChem CID | 15942292 |
| Molecular Formula | C26H43NO2SSi |
| Molecular Weight | 461.79 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | triethyl-[(2E,4S,5R,6E)-7-(N-methyl-S-phenylsulfonimidoyl)-5-propan-2-yldeca-2,6,9-trien-4-yl]oxysilane |
| SMILES | C=CC/C(=C\[C@@H](C(C)C)[C@H](/C=C/C)O[Si](CC)(CC)CC)S(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C26H43NO2SSi/c1-9-17-24(30(28,27-8)23-19-15-14-16-20-23)21-25(22(6)7)26(18-10-2)29-31(11-3,12-4)13-5/h9-10,14-16,18-22,25-26H,1,11-13,17H2,2-8H3/b18-10+,24-21+/t25-,26-,30?/m0/s1 |
| InChIKey | LOHUVDMGYITPRR-DJCCLERXSA-N |
| XLogP | 7.84 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.79 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|