C28H39NO2SSi — CID 101200010
triethyl-[(Z,3R,4S)-6-(N-methyl-S-phenylsulfonimidoyl)-1-phenyl-4-propan-2-ylhex-5-en-1-yn-3-yl]oxysilane (PubChem CID 101200010) has the molecular formula C28H39NO2SSi and a molecular weight of 481.78 g/mol. Its IUPAC name is triethyl-[(Z,3R,4S)-6-(N-methyl-S-phenylsulfonimidoyl)-1-phenyl-4-propan-2-ylhex-5-en-1-yn-3-yl]oxysilane.
| Compound Name | triethyl-[(Z,3R,4S)-6-(N-methyl-S-phenylsulfonimidoyl)-1-phenyl-4-propan-2-ylhex-5-en-1-yn-3-yl]oxysilane |
|---|---|
| PubChem CID | 101200010 |
| Molecular Formula | C28H39NO2SSi |
| Molecular Weight | 481.78 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | triethyl-[(Z,3R,4S)-6-(N-methyl-S-phenylsulfonimidoyl)-1-phenyl-4-propan-2-ylhex-5-en-1-yn-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C#Cc1ccccc1)[C@H](/C=C\S(=O)(=NC)c1ccccc1)C(C)C |
| InChI | InChI=1S/C28H39NO2SSi/c1-7-33(8-2,9-3)31-28(21-20-25-16-12-10-13-17-25)27(24(4)5)22-23-32(30,29-6)26-18-14-11-15-19-26/h10-19,22-24,27-28H,7-9H2,1-6H3/b23-22-/t27-,28+,32?/m1/s1 |
| InChIKey | YGCDIESLBJGABT-PCTWNWJZSA-N |
| XLogP | 7.37 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.78 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|