C26H39NO2SSi — CID 10718677
triethyl-[(Z,3S,4S)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxysilane (PubChem CID 10718677) has the molecular formula C26H39NO2SSi and a molecular weight of 457.76 g/mol. Its IUPAC name is triethyl-[(Z,3S,4S)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxysilane.
| Compound Name | triethyl-[(Z,3S,4S)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxysilane |
|---|---|
| PubChem CID | 10718677 |
| Molecular Formula | C26H39NO2SSi |
| Molecular Weight | 457.76 g/mol |
| Exact Mass | 457.25 |
| IUPAC Name | triethyl-[(Z,3S,4S)-2-methyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxysilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(C)C)[C@@H](/C=C\S(=O)(=NC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H39NO2SSi/c1-7-31(8-2,9-3)29-26(22(4)5)25(23-16-12-10-13-17-23)20-21-30(28,27-6)24-18-14-11-15-19-24/h10-22,25-26H,7-9H2,1-6H3/b21-20-/t25-,26-,30?/m0/s1 |
| InChIKey | HSEBRGYACZPIMQ-OQODNWTBSA-N |
| XLogP | 7.49 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.76 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|