C30H49NO3SSi — CID 175668187
(1E)-1-(N-methyl-S-phenylsulfonimidoyl)-1-[(2R)-2-[(1S)-2-methyl-1-triethylsilyloxypropyl]cyclohexylidene]hept-6-en-2-one (PubChem CID 175668187) has the molecular formula C30H49NO3SSi and a molecular weight of 531.88 g/mol. Its IUPAC name is (1E)-1-(N-methyl-S-phenylsulfonimidoyl)-1-[(2R)-2-[(1S)-2-methyl-1-triethylsilyloxypropyl]cyclohexylidene]hept-6-en-2-one.
| Compound Name | (1E)-1-(N-methyl-S-phenylsulfonimidoyl)-1-[(2R)-2-[(1S)-2-methyl-1-triethylsilyloxypropyl]cyclohexylidene]hept-6-en-2-one |
|---|---|
| PubChem CID | 175668187 |
| Molecular Formula | C30H49NO3SSi |
| Molecular Weight | 531.88 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | (1E)-1-(N-methyl-S-phenylsulfonimidoyl)-1-[(2R)-2-[(1S)-2-methyl-1-triethylsilyloxypropyl]cyclohexylidene]hept-6-en-2-one |
| SMILES | C=CCCCC(=O)/C(=C1/CCCC[C@H]1[C@@H](O[Si](CC)(CC)CC)C(C)C)[S@@](=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C30H49NO3SSi/c1-8-12-14-23-28(32)30(35(33,31-7)25-19-15-13-16-20-25)27-22-18-17-21-26(27)29(24(5)6)34-36(9-2,10-3)11-4/h8,13,15-16,19-20,24,26,29H,1,9-12,14,17-18,21-23H2,2-7H3/b30-27+/t26-,29+,35-/m1/s1 |
| InChIKey | IWIFJZFOGITRIY-HYXRNCDBSA-N |
| XLogP | 8.56 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.88 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|