C27H41NO2SSi — CID 11059773
[(Z,3S,4R)-2,5-dimethyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxy-triethylsilane (PubChem CID 11059773) has the molecular formula C27H41NO2SSi and a molecular weight of 471.78 g/mol. Its IUPAC name is [(Z,3S,4R)-2,5-dimethyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxy-triethylsilane.
| Compound Name | [(Z,3S,4R)-2,5-dimethyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 11059773 |
| Molecular Formula | C27H41NO2SSi |
| Molecular Weight | 471.78 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | [(Z,3S,4R)-2,5-dimethyl-6-(N-methyl-S-phenylsulfonimidoyl)-4-phenylhex-5-en-3-yl]oxy-triethylsilane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(C)C)[C@@H](/C(C)=C\S(=O)(=NC)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H41NO2SSi/c1-8-32(9-2,10-3)30-27(22(4)5)26(24-17-13-11-14-18-24)23(6)21-31(29,28-7)25-19-15-12-16-20-25/h11-22,26-27H,8-10H2,1-7H3/b23-21-/t26-,27-,31?/m0/s1 |
| InChIKey | VBDOIARYPMUQTH-HTFZCDRASA-N |
| XLogP | 7.88 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.78 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|