C24H41NO2SSi — CID 24999386
triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclohexyl]propoxy]silane (PubChem CID 24999386) has the molecular formula C24H41NO2SSi and a molecular weight of 435.75 g/mol. Its IUPAC name is triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclohexyl]propoxy]silane.
| Compound Name | triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclohexyl]propoxy]silane |
|---|---|
| PubChem CID | 24999386 |
| Molecular Formula | C24H41NO2SSi |
| Molecular Weight | 435.75 g/mol |
| Exact Mass | 435.26 |
| IUPAC Name | triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclohexyl]propoxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(C)C)[C@@H]1CCCC/C1=C/[S@@](=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C24H41NO2SSi/c1-7-29(8-2,9-3)27-24(20(4)5)23-18-14-13-15-21(23)19-28(26,25-6)22-16-11-10-12-17-22/h10-12,16-17,19-20,23-24H,7-9,13-15,18H2,1-6H3/b21-19-/t23-,24+,28+/m1/s1 |
| InChIKey | NASKMUZSYMBPOY-UOEOGRDESA-N |
| XLogP | 7.26 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|