C23H39NO2SSi — CID 10873521
triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclopentyl]propoxy]silane (PubChem CID 10873521) has the molecular formula C23H39NO2SSi and a molecular weight of 421.72 g/mol. Its IUPAC name is triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclopentyl]propoxy]silane.
| Compound Name | triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclopentyl]propoxy]silane |
|---|---|
| PubChem CID | 10873521 |
| Molecular Formula | C23H39NO2SSi |
| Molecular Weight | 421.72 g/mol |
| Exact Mass | 421.25 |
| IUPAC Name | triethyl-[(1S)-2-methyl-1-[(1R,2Z)-2-[(N-methyl-S-phenylsulfonimidoyl)methylidene]cyclopentyl]propoxy]silane |
| SMILES | CC[Si](CC)(CC)O[C@@H](C(C)C)[C@@H]1CCC/C1=C/S(=O)(=NC)c1ccccc1 |
| InChI | InChI=1S/C23H39NO2SSi/c1-7-28(8-2,9-3)26-23(19(4)5)22-17-13-14-20(22)18-27(25,24-6)21-15-11-10-12-16-21/h10-12,15-16,18-19,22-23H,7-9,13-14,17H2,1-6H3/b20-18-/t22-,23+,27?/m1/s1 |
| InChIKey | USFQQTLUAMCNDT-VDALHZLUSA-N |
| XLogP | 6.87 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.72 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|