C20H34O2SSi — CID 10044452
[(E,2R,5S)-5-(benzenesulfinyl)-2,4-dimethylhex-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 10044452) has the molecular formula C20H34O2SSi and a molecular weight of 366.64 g/mol. Its IUPAC name is [(E,2R,5S)-5-(benzenesulfinyl)-2,4-dimethylhex-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R,5S)-5-(benzenesulfinyl)-2,4-dimethylhex-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10044452 |
| Molecular Formula | C20H34O2SSi |
| Molecular Weight | 366.64 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(E,2R,5S)-5-(benzenesulfinyl)-2,4-dimethylhex-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C/C(=C\[C@@H](C)CO[Si](C)(C)C(C)(C)C)[C@H](C)S(=O)c1ccccc1 |
| InChI | InChI=1S/C20H34O2SSi/c1-16(15-22-24(7,8)20(4,5)6)14-17(2)18(3)23(21)19-12-10-9-11-13-19/h9-14,16,18H,15H2,1-8H3/b17-14+/t16-,18+,23?/m1/s1 |
| InChIKey | DQJTXMQFEVHRRV-CJUXKXOKSA-N |
| XLogP | 5.79 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.64 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|