C32H52O3SSi — CID 10973609
[(E,2R,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-5-(benzenesulfonyl)-3-methylpent-4-en-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 10973609) has the molecular formula C32H52O3SSi and a molecular weight of 544.92 g/mol. Its IUPAC name is [(E,2R,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-5-(benzenesulfonyl)-3-methylpent-4-en-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,2R,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-5-(benzenesulfonyl)-3-methylpent-4-en-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 10973609 |
| Molecular Formula | C32H52O3SSi |
| Molecular Weight | 544.92 g/mol |
| Exact Mass | 544.34 |
| IUPAC Name | [(E,2R,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-5-(benzenesulfonyl)-3-methylpent-4-en-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](C)/C=C/S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H52O3SSi/c1-24-17-18-29-31(6,7)20-14-21-32(29,8)27(24)23-28(35-37(9,10)30(3,4)5)25(2)19-22-36(33,34)26-15-12-11-13-16-26/h11-13,15-17,19,22,25,27-29H,14,18,20-21,23H2,1-10H3/b22-19+/t25-,27+,28-,29+,32-/m1/s1 |
| InChIKey | XHNREQKUXQUPIG-ILLMGMGUSA-N |
| XLogP | 9.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.92 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|