C31H48O6S — CID 11757748
[(Z,2R,3R)-1-[(1S,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-9-(2,5-dihydroxyphenyl)-3,7-dimethylnon-7-en-2-yl] hydrogen sulfate (PubChem CID 11757748) has the molecular formula C31H48O6S and a molecular weight of 548.79 g/mol. Its IUPAC name is [(Z,2R,3R)-1-[(1S,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-9-(2,5-dihydroxyphenyl)-3,7-dimethylnon-7-en-2-yl] hydrogen sulfate.
| Compound Name | [(Z,2R,3R)-1-[(1S,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-9-(2,5-dihydroxyphenyl)-3,7-dimethylnon-7-en-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 11757748 |
| Molecular Formula | C31H48O6S |
| Molecular Weight | 548.79 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | [(Z,2R,3R)-1-[(1S,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-9-(2,5-dihydroxyphenyl)-3,7-dimethylnon-7-en-2-yl] hydrogen sulfate |
| SMILES | CC1=CCC2C(C)(C)CCC[C@]2(C)[C@H]1C[C@@H](OS(=O)(=O)O)[C@H](C)CCC/C(C)=C\Cc1cc(O)ccc1O |
| InChI | InChI=1S/C31H48O6S/c1-21(11-13-24-19-25(32)14-15-27(24)33)9-7-10-23(3)28(37-38(34,35)36)20-26-22(2)12-16-29-30(4,5)17-8-18-31(26,29)6/h11-12,14-15,19,23,26,28-29,32-33H,7-10,13,16-18,20H2,1-6H3,(H,34,35,36)/b21-11-/t23-,26+,28-,29?,31-/m1/s1 |
| InChIKey | VCFONRYZIFVUGC-PBKMASQUSA-N |
| XLogP | 7.77 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.79 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|