C31H45O7S- — CID 23242141
[(1E,6E)-2-[2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-8-(2,5-dihydroxyphenyl)-5-hydroxy-6-methylocta-1,6-dienyl] sulfate (PubChem CID 23242141) has the molecular formula C31H45O7S- and a molecular weight of 561.76 g/mol. Its IUPAC name is [(1E,6E)-2-[2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-8-(2,5-dihydroxyphenyl)-5-hydroxy-6-methylocta-1,6-dienyl] sulfate.
| Compound Name | [(1E,6E)-2-[2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-8-(2,5-dihydroxyphenyl)-5-hydroxy-6-methylocta-1,6-dienyl] sulfate |
|---|---|
| PubChem CID | 23242141 |
| Molecular Formula | C31H45O7S- |
| Molecular Weight | 561.76 g/mol |
| Exact Mass | 561.29 |
| IUPAC Name | [(1E,6E)-2-[2-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]ethyl]-8-(2,5-dihydroxyphenyl)-5-hydroxy-6-methylocta-1,6-dienyl] sulfate |
| SMILES | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1CC/C(=C\OS(=O)(=O)[O-])CCC(O)/C(C)=C/Cc1cc(O)ccc1O |
| InChI | InChI=1S/C31H46O7S/c1-21-8-16-29-30(3,4)17-6-18-31(29,5)26(21)13-9-23(20-38-39(35,36)37)10-14-27(33)22(2)7-11-24-19-25(32)12-15-28(24)34/h7-8,12,15,19-20,26-27,29,32-34H,6,9-11,13-14,16-18H2,1-5H3,(H,35,36,37)/p-1/b22-7+,23-20+/t26-,27?,29-,31+/m0/s1 |
| InChIKey | WXHXYFQDYWLRMT-VDDWEQCZSA-M |
| XLogP | 6.67 |
| TPSA | 127.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.76 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|