C28H48N3O5S- — CID 23426071
[(2S,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-6-(furan-3-yl)-3-methylhexan-2-yl] [[amino(dimethylamino)methyl]amino] sulfate (PubChem CID 23426071) has the molecular formula C28H48N3O5S- and a molecular weight of 538.78 g/mol. Its IUPAC name is [(2S,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-6-(furan-3-yl)-3-methylhexan-2-yl] [[amino(dimethylamino)methyl]amino] sulfate.
| Compound Name | [(2S,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-6-(furan-3-yl)-3-methylhexan-2-yl] [[amino(dimethylamino)methyl]amino] sulfate |
|---|---|
| PubChem CID | 23426071 |
| Molecular Formula | C28H48N3O5S- |
| Molecular Weight | 538.78 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | [(2S,3R)-1-[(1S,4aS,8aS)-2,5,5,8a-tetramethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-6-(furan-3-yl)-3-methylhexan-2-yl] [[amino(dimethylamino)methyl]amino] sulfate |
| SMILES | CC1=CC[C@H]2C(C)(C)CCC[C@]2(C)[C@H]1C[C@H](OS(=O)(=O)ON[C-](N)N(C)C)[C@H](C)CCCc1ccoc1 |
| InChI | InChI=1S/C28H48N3O5S/c1-20-12-13-25-27(3,4)15-9-16-28(25,5)23(20)18-24(21(2)10-8-11-22-14-17-34-19-22)35-37(32,33)36-30-26(29)31(6)7/h12,14,17,19,21,23-25,30H,8-11,13,15-16,18,29H2,1-7H3/q-1/t21-,23+,24+,25+,28-/m1/s1 |
| InChIKey | PNZVQYJDTKFBQS-IZRCBWFOSA-N |
| XLogP | 5.55 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.78 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|