C17H22O5S — CID 11325227
2-[2-(4-methylsulfonylphenyl)-3-(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propyl]oxirane (PubChem CID 11325227) has the molecular formula C17H22O5S and a molecular weight of 338.43 g/mol. Its IUPAC name is 2-[2-(4-methylsulfonylphenyl)-3-(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propyl]oxirane.
| Compound Name | 2-[2-(4-methylsulfonylphenyl)-3-(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propyl]oxirane |
|---|---|
| PubChem CID | 11325227 |
| Molecular Formula | C17H22O5S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-[2-(4-methylsulfonylphenyl)-3-(oxiran-2-yl)-2-(oxiran-2-ylmethyl)propyl]oxirane |
| SMILES | CS(=O)(=O)c1ccc(C(CC2CO2)(CC2CO2)CC2CO2)cc1 |
| InChI | InChI=1S/C17H22O5S/c1-23(18,19)16-4-2-12(3-5-16)17(6-13-9-20-13,7-14-10-21-14)8-15-11-22-15/h2-5,13-15H,6-11H2,1H3 |
| InChIKey | SZCCZKXWKWWYJZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 71.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|