C24H42O5SSi — CID 134836960
[(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-pentyloxan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 134836960) has the molecular formula C24H42O5SSi and a molecular weight of 470.75 g/mol. Its IUPAC name is [(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-pentyloxan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-pentyloxan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134836960 |
| Molecular Formula | C24H42O5SSi |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | [(2S,4R,6S)-4-[tert-butyl(dimethyl)silyl]oxy-6-pentyloxan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | CCCCC[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H](COS(=O)(=O)c2ccc(C)cc2)O1 |
| InChI | InChI=1S/C24H42O5SSi/c1-8-9-10-11-20-16-21(29-31(6,7)24(3,4)5)17-22(28-20)18-27-30(25,26)23-14-12-19(2)13-15-23/h12-15,20-22H,8-11,16-18H2,1-7H3/t20-,21+,22-/m0/s1 |
| InChIKey | CIOHWSXSZVMGHP-BDTNDASRSA-N |
| XLogP | 6.22 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|