C37H54O4SSi2 — CID 102002045
[(1R)-1-[(1S,2S)-2-(benzenesulfonylmethyl)cyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentoxy]-tert-butyl-diphenylsilane (PubChem CID 102002045) has the molecular formula C37H54O4SSi2 and a molecular weight of 651.07 g/mol. Its IUPAC name is [(1R)-1-[(1S,2S)-2-(benzenesulfonylmethyl)cyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(1R)-1-[(1S,2S)-2-(benzenesulfonylmethyl)cyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 102002045 |
| Molecular Formula | C37H54O4SSi2 |
| Molecular Weight | 651.07 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | [(1R)-1-[(1S,2S)-2-(benzenesulfonylmethyl)cyclopropyl]-5-[tert-butyl(dimethyl)silyl]oxypentoxy]-tert-butyl-diphenylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC[C@@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1C[C@@H]1CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C37H54O4SSi2/c1-36(2,3)43(7,8)40-27-19-18-26-35(34-28-30(34)29-42(38,39)31-20-12-9-13-21-31)41-44(37(4,5)6,32-22-14-10-15-23-32)33-24-16-11-17-25-33/h9-17,20-25,30,34-35H,18-19,26-29H2,1-8H3/t30-,34+,35-/m1/s1 |
| InChIKey | DLIOLWGDCMGQCL-JHOVWCEZSA-N |
| XLogP | 8.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.07 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|