C22H34O5S3 — CID 134847181
(7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7-[2-(2-ethoxyethoxy)ethyl]-10-oxa-1,4-dithiaspiro[4.5]decane (PubChem CID 134847181) has the molecular formula C22H34O5S3 and a molecular weight of 474.71 g/mol. Its IUPAC name is (7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7-[2-(2-ethoxyethoxy)ethyl]-10-oxa-1,4-dithiaspiro[4.5]decane.
| Compound Name | (7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7-[2-(2-ethoxyethoxy)ethyl]-10-oxa-1,4-dithiaspiro[4.5]decane |
|---|---|
| PubChem CID | 134847181 |
| Molecular Formula | C22H34O5S3 |
| Molecular Weight | 474.71 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (7R)-9-[(2S)-1-(benzenesulfonyl)propan-2-yl]-7-[2-(2-ethoxyethoxy)ethyl]-10-oxa-1,4-dithiaspiro[4.5]decane |
| SMILES | CCOCCOCC[C@@H]1CC([C@H](C)CS(=O)(=O)c2ccccc2)OC2(C1)SCCS2 |
| InChI | InChI=1S/C22H34O5S3/c1-3-25-11-12-26-10-9-19-15-21(27-22(16-19)28-13-14-29-22)18(2)17-30(23,24)20-7-5-4-6-8-20/h4-8,18-19,21H,3,9-17H2,1-2H3/t18-,19-,21?/m1/s1 |
| InChIKey | JGAJRPKYNZWQRJ-AQFHOAJTSA-N |
| XLogP | 4.47 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|