C26H44O5SSi — CID 134940080
(4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-ol (PubChem CID 134940080) has the molecular formula C26H44O5SSi and a molecular weight of 496.79 g/mol. Its IUPAC name is (4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-ol.
| Compound Name | (4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-ol |
|---|---|
| PubChem CID | 134940080 |
| Molecular Formula | C26H44O5SSi |
| Molecular Weight | 496.79 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | (4R)-3-(benzenesulfonyl)-5-[tert-butyl(dimethyl)silyl]oxy-2-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]-4-methylpentan-2-ol |
| SMILES | CC[C@H]1O[C@@H](C(C)(O)C([C@H](C)CO[Si](C)(C)C(C)(C)C)S(=O)(=O)c2ccccc2)CC=C1C |
| InChI | InChI=1S/C26H44O5SSi/c1-10-22-19(2)16-17-23(31-22)26(7,27)24(32(28,29)21-14-12-11-13-15-21)20(3)18-30-33(8,9)25(4,5)6/h11-16,20,22-24,27H,10,17-18H2,1-9H3/t20-,22-,23-,24?,26?/m1/s1 |
| InChIKey | BXSYRDURBQNGJZ-RJJYAXQESA-N |
| XLogP | 5.75 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.79 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|