C21H32O4S — CID 14704704
(2R,3S,6E)-5-(benzenesulfonyl)-3,7,11-trimethyldodeca-6,10-diene-2,3-diol (PubChem CID 14704704) has the molecular formula C21H32O4S and a molecular weight of 380.55 g/mol. Its IUPAC name is (2R,3S,6E)-5-(benzenesulfonyl)-3,7,11-trimethyldodeca-6,10-diene-2,3-diol.
| Compound Name | (2R,3S,6E)-5-(benzenesulfonyl)-3,7,11-trimethyldodeca-6,10-diene-2,3-diol |
|---|---|
| PubChem CID | 14704704 |
| Molecular Formula | C21H32O4S |
| Molecular Weight | 380.55 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | (2R,3S,6E)-5-(benzenesulfonyl)-3,7,11-trimethyldodeca-6,10-diene-2,3-diol |
| SMILES | CC(C)=CCC/C(C)=C/C(C[C@](C)(O)[C@@H](C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H32O4S/c1-16(2)10-9-11-17(3)14-20(15-21(5,23)18(4)22)26(24,25)19-12-7-6-8-13-19/h6-8,10,12-14,18,20,22-23H,9,11,15H2,1-5H3/b17-14+/t18-,20?,21+/m1/s1 |
| InChIKey | WRRDFKIEMLGFNO-GXSIVPSMSA-N |
| XLogP | 4.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|