C16H22O3S — CID 131854697
5-(benzenesulfonyl)-3,7-dimethylocta-1,6-dien-3-ol (PubChem CID 131854697) has the molecular formula C16H22O3S and a molecular weight of 294.42 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-3,7-dimethylocta-1,6-dien-3-ol.
| Compound Name | 5-(benzenesulfonyl)-3,7-dimethylocta-1,6-dien-3-ol |
|---|---|
| PubChem CID | 131854697 |
| Molecular Formula | C16H22O3S |
| Molecular Weight | 294.42 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 5-(benzenesulfonyl)-3,7-dimethylocta-1,6-dien-3-ol |
| SMILES | C=CC(C)(O)CC(C=C(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H22O3S/c1-5-16(4,17)12-15(11-13(2)3)20(18,19)14-9-7-6-8-10-14/h5-11,15,17H,1,12H2,2-4H3 |
| InChIKey | NQLVKHFWVLZEIW-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|