C15H21FO3S — CID 10518323
(2R,3R)-3-fluoro-2-[[(S)-(4-methylphenyl)sulfinyl]methyl]hept-6-ene-1,2-diol (PubChem CID 10518323) has the molecular formula C15H21FO3S and a molecular weight of 300.40 g/mol. Its IUPAC name is (2R,3R)-3-fluoro-2-[[(S)-(4-methylphenyl)sulfinyl]methyl]hept-6-ene-1,2-diol.
| Compound Name | (2R,3R)-3-fluoro-2-[[(S)-(4-methylphenyl)sulfinyl]methyl]hept-6-ene-1,2-diol |
|---|---|
| PubChem CID | 10518323 |
| Molecular Formula | C15H21FO3S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | (2R,3R)-3-fluoro-2-[[(S)-(4-methylphenyl)sulfinyl]methyl]hept-6-ene-1,2-diol |
| SMILES | C=CCC[C@@H](F)[C@](O)(CO)C[S@](=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H21FO3S/c1-3-4-5-14(16)15(18,10-17)11-20(19)13-8-6-12(2)7-9-13/h3,6-9,14,17-18H,1,4-5,10-11H2,2H3/t14-,15+,20+/m1/s1 |
| InChIKey | RKUVRFDZYMNTIZ-SIFCLUCFSA-N |
| XLogP | 2.13 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|