C19H26O4S — CID 135021768
(E)-8-(benzenesulfonyl)-2,6-dimethylundec-6-en-10-yne-2,3-diol (PubChem CID 135021768) has the molecular formula C19H26O4S and a molecular weight of 350.48 g/mol. Its IUPAC name is (E)-8-(benzenesulfonyl)-2,6-dimethylundec-6-en-10-yne-2,3-diol.
| Compound Name | (E)-8-(benzenesulfonyl)-2,6-dimethylundec-6-en-10-yne-2,3-diol |
|---|---|
| PubChem CID | 135021768 |
| Molecular Formula | C19H26O4S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | (E)-8-(benzenesulfonyl)-2,6-dimethylundec-6-en-10-yne-2,3-diol |
| SMILES | C#CCC(/C=C(\C)CCC(O)C(C)(C)O)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C19H26O4S/c1-5-9-17(24(22,23)16-10-7-6-8-11-16)14-15(2)12-13-18(20)19(3,4)21/h1,6-8,10-11,14,17-18,20-21H,9,12-13H2,2-4H3/b15-14+ |
| InChIKey | DDJQMHVWNMYDMD-CCEZHUSRSA-N |
| XLogP | 2.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|