C16H20O3S — CID 135049970
1-(benzenesulfonyl)dec-9-en-2-yn-5-ol (PubChem CID 135049970) has the molecular formula C16H20O3S and a molecular weight of 292.40 g/mol. Its IUPAC name is 1-(benzenesulfonyl)dec-9-en-2-yn-5-ol.
| Compound Name | 1-(benzenesulfonyl)dec-9-en-2-yn-5-ol |
|---|---|
| PubChem CID | 135049970 |
| Molecular Formula | C16H20O3S |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 1-(benzenesulfonyl)dec-9-en-2-yn-5-ol |
| SMILES | C=CCCCC(O)CC#CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C16H20O3S/c1-2-3-5-10-15(17)11-8-9-14-20(18,19)16-12-6-4-7-13-16/h2,4,6-7,12-13,15,17H,1,3,5,10-11,14H2 |
| InChIKey | MTSOZVLRPDIXOM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|