C16H18O3S — CID 10062817
10-(benzenesulfonyl)deca-2,8-diyn-1-ol (PubChem CID 10062817) has the molecular formula C16H18O3S and a molecular weight of 290.38 g/mol. Its IUPAC name is 10-(benzenesulfonyl)deca-2,8-diyn-1-ol.
| Compound Name | 10-(benzenesulfonyl)deca-2,8-diyn-1-ol |
|---|---|
| PubChem CID | 10062817 |
| Molecular Formula | C16H18O3S |
| Molecular Weight | 290.38 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 10-(benzenesulfonyl)deca-2,8-diyn-1-ol |
| SMILES | O=S(=O)(CC#CCCCCC#CCO)c1ccccc1 |
| InChI | InChI=1S/C16H18O3S/c17-14-10-5-3-1-2-4-6-11-15-20(18,19)16-12-8-7-9-13-16/h7-9,12-13,17H,1-4,14-15H2 |
| InChIKey | PVGHRVIZDYZAQO-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.38 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|