C22H34O5S — CID 134931274
(2S)-2-[(2R,5S)-5-[3-(benzenesulfonyl)-1-hydroxypropyl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol (PubChem CID 134931274) has the molecular formula C22H34O5S and a molecular weight of 410.58 g/mol. Its IUPAC name is (2S)-2-[(2R,5S)-5-[3-(benzenesulfonyl)-1-hydroxypropyl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol.
| Compound Name | (2S)-2-[(2R,5S)-5-[3-(benzenesulfonyl)-1-hydroxypropyl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol |
|---|---|
| PubChem CID | 134931274 |
| Molecular Formula | C22H34O5S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | (2S)-2-[(2R,5S)-5-[3-(benzenesulfonyl)-1-hydroxypropyl]-5-methyloxolan-2-yl]-6-methylhept-5-en-2-ol |
| SMILES | CC(C)=CCC[C@](C)(O)[C@H]1CC[C@@](C)(C(O)CCS(=O)(=O)c2ccccc2)O1 |
| InChI | InChI=1S/C22H34O5S/c1-17(2)9-8-14-21(3,24)20-12-15-22(4,27-20)19(23)13-16-28(25,26)18-10-6-5-7-11-18/h5-7,9-11,19-20,23-24H,8,12-16H2,1-4H3/t19?,20-,21+,22+/m1/s1 |
| InChIKey | MJULEXQVBFDWBL-FTMYTLCRSA-N |
| XLogP | 3.65 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|