C19H30O4S — CID 10784342
(1R)-1-[(2S,3S)-3-butyl-2-tert-butylsulfonyloxiran-2-yl]-3-phenylpropan-1-ol (PubChem CID 10784342) has the molecular formula C19H30O4S and a molecular weight of 354.51 g/mol. Its IUPAC name is (1R)-1-[(2S,3S)-3-butyl-2-tert-butylsulfonyloxiran-2-yl]-3-phenylpropan-1-ol.
| Compound Name | (1R)-1-[(2S,3S)-3-butyl-2-tert-butylsulfonyloxiran-2-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 10784342 |
| Molecular Formula | C19H30O4S |
| Molecular Weight | 354.51 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (1R)-1-[(2S,3S)-3-butyl-2-tert-butylsulfonyloxiran-2-yl]-3-phenylpropan-1-ol |
| SMILES | CCCC[C@@H]1O[C@@]1([C@H](O)CCc1ccccc1)S(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C19H30O4S/c1-5-6-12-17-19(23-17,24(21,22)18(2,3)4)16(20)14-13-15-10-8-7-9-11-15/h7-11,16-17,20H,5-6,12-14H2,1-4H3/t16-,17+,19+/m1/s1 |
| InChIKey | JWNFFSZSYXMNIG-AOIWGVFYSA-N |
| XLogP | 3.48 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|