C16H22O4S — CID 10968930
[3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2-methyloxiran-2-yl]methanol (PubChem CID 10968930) has the molecular formula C16H22O4S and a molecular weight of 310.41 g/mol. Its IUPAC name is [3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2-methyloxiran-2-yl]methanol.
| Compound Name | [3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2-methyloxiran-2-yl]methanol |
|---|---|
| PubChem CID | 10968930 |
| Molecular Formula | C16H22O4S |
| Molecular Weight | 310.41 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [3-[(E)-5-(benzenesulfonyl)-3-methylpent-3-enyl]-2-methyloxiran-2-yl]methanol |
| SMILES | C/C(=C\CS(=O)(=O)c1ccccc1)CCC1OC1(C)CO |
| InChI | InChI=1S/C16H22O4S/c1-13(8-9-15-16(2,12-17)20-15)10-11-21(18,19)14-6-4-3-5-7-14/h3-7,10,15,17H,8-9,11-12H2,1-2H3/b13-10+ |
| InChIKey | JGLWTRSNRWLRAJ-JLHYYAGUSA-N |
| XLogP | 2.34 |
| TPSA | 66.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|