C15H22O5S2 — CID 135050634
[(2S)-2-hydroxy-2-[(2S)-6-methyl-6-phenylsulfanyloxan-2-yl]ethyl] methanesulfonate (PubChem CID 135050634) has the molecular formula C15H22O5S2 and a molecular weight of 346.47 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-[(2S)-6-methyl-6-phenylsulfanyloxan-2-yl]ethyl] methanesulfonate.
| Compound Name | [(2S)-2-hydroxy-2-[(2S)-6-methyl-6-phenylsulfanyloxan-2-yl]ethyl] methanesulfonate |
|---|---|
| PubChem CID | 135050634 |
| Molecular Formula | C15H22O5S2 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | [(2S)-2-hydroxy-2-[(2S)-6-methyl-6-phenylsulfanyloxan-2-yl]ethyl] methanesulfonate |
| SMILES | CC1(Sc2ccccc2)CCC[C@@H]([C@@H](O)COS(C)(=O)=O)O1 |
| InChI | InChI=1S/C15H22O5S2/c1-15(21-12-7-4-3-5-8-12)10-6-9-14(20-15)13(16)11-19-22(2,17)18/h3-5,7-8,13-14,16H,6,9-11H2,1-2H3/t13-,14-,15?/m0/s1 |
| InChIKey | XZNVWPZBRHLELO-ZYOSVBKOSA-N |
| XLogP | 2.40 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|