C24H34O5SSi — CID 10322135
1-[(2R,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-phenylpropan-1-ol (PubChem CID 10322135) has the molecular formula C24H34O5SSi and a molecular weight of 462.68 g/mol. Its IUPAC name is 1-[(2R,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-phenylpropan-1-ol.
| Compound Name | 1-[(2R,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-phenylpropan-1-ol |
|---|---|
| PubChem CID | 10322135 |
| Molecular Formula | C24H34O5SSi |
| Molecular Weight | 462.68 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[(2R,3R)-2-(benzenesulfonyl)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]oxiran-2-yl]-3-phenylpropan-1-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@]1(C(O)CCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H34O5SSi/c1-23(2,3)31(4,5)28-18-22-24(29-22,30(26,27)20-14-10-7-11-15-20)21(25)17-16-19-12-8-6-9-13-19/h6-15,21-22,25H,16-18H2,1-5H3/t21?,22-,24-/m1/s1 |
| InChIKey | WSGYTXGHUHFIMT-YUWPFLFCSA-N |
| XLogP | 4.57 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.68 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|