C26H36O5SSi — CID 135012729
(Z,2S)-4-(benzenesulfonyl)-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]-4-triethylsilylbut-3-en-1-ol (PubChem CID 135012729) has the molecular formula C26H36O5SSi and a molecular weight of 488.72 g/mol. Its IUPAC name is (Z,2S)-4-(benzenesulfonyl)-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]-4-triethylsilylbut-3-en-1-ol.
| Compound Name | (Z,2S)-4-(benzenesulfonyl)-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]-4-triethylsilylbut-3-en-1-ol |
|---|---|
| PubChem CID | 135012729 |
| Molecular Formula | C26H36O5SSi |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | (Z,2S)-4-(benzenesulfonyl)-2-[(2S,3S)-3-(phenylmethoxymethyl)oxiran-2-yl]-4-triethylsilylbut-3-en-1-ol |
| SMILES | CC[Si](CC)(CC)/C(=C/[C@@H](CO)[C@@H]1O[C@H]1COCc1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H36O5SSi/c1-4-33(5-2,6-3)25(32(28,29)23-15-11-8-12-16-23)17-22(18-27)26-24(31-26)20-30-19-21-13-9-7-10-14-21/h7-17,22,24,26-27H,4-6,18-20H2,1-3H3/b25-17+/t22-,24-,26-/m0/s1 |
| InChIKey | QSQFYXWXZUQASH-SHTWIICXSA-N |
| XLogP | 4.98 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|