C26H38O5SSi — CID 134844215
[(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate (PubChem CID 134844215) has the molecular formula C26H38O5SSi and a molecular weight of 490.74 g/mol. Its IUPAC name is [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 134844215 |
| Molecular Formula | C26H38O5SSi |
| Molecular Weight | 490.74 g/mol |
| Exact Mass | 490.22 |
| IUPAC Name | [(2R,3S)-1-[tert-butyl(dimethyl)silyl]oxy-3-phenylmethoxyhex-5-en-2-yl] 4-methylbenzenesulfonate |
| SMILES | C=CC[C@H](OCc1ccccc1)[C@@H](CO[Si](C)(C)C(C)(C)C)OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C26H38O5SSi/c1-8-12-24(29-19-22-13-10-9-11-14-22)25(20-30-33(6,7)26(3,4)5)31-32(27,28)23-17-15-21(2)16-18-23/h8-11,13-18,24-25H,1,12,19-20H2,2-7H3/t24-,25+/m0/s1 |
| InChIKey | JKVHJGWGJDVRNG-LOSJGSFVSA-N |
| XLogP | 6.25 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.74 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|