C32H34O8S2 — CID 14085263
[(2S,3S)-4-(4-methylphenyl)sulfonyloxy-2,3-bis(phenylmethoxy)butyl] 4-methylbenzenesulfonate (PubChem CID 14085263) has the molecular formula C32H34O8S2 and a molecular weight of 610.75 g/mol. Its IUPAC name is [(2S,3S)-4-(4-methylphenyl)sulfonyloxy-2,3-bis(phenylmethoxy)butyl] 4-methylbenzenesulfonate.
| Compound Name | [(2S,3S)-4-(4-methylphenyl)sulfonyloxy-2,3-bis(phenylmethoxy)butyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14085263 |
| Molecular Formula | C32H34O8S2 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.17 |
| IUPAC Name | [(2S,3S)-4-(4-methylphenyl)sulfonyloxy-2,3-bis(phenylmethoxy)butyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H](OCc2ccccc2)[C@H](COS(=O)(=O)c2ccc(C)cc2)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C32H34O8S2/c1-25-13-17-29(18-14-25)41(33,34)39-23-31(37-21-27-9-5-3-6-10-27)32(38-22-28-11-7-4-8-12-28)24-40-42(35,36)30-19-15-26(2)16-20-30/h3-20,31-32H,21-24H2,1-2H3/t31-,32-/m0/s1 |
| InChIKey | HBMFCIXHYWBPOV-ACHIHNKUSA-N |
| XLogP | 5.59 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|